Difference between revisions of "Triacylglycerides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18863 == * transcription-direction: ** negative * right-end-position: ** 98043 * left-end-position: ** 74801 * centisome-position: ** 31.829807...")
(Created page with "Category:metabolite == Metabolite LEUCOPELARGONIDIN-CMPD == * common-name: ** (2r,3s,4s)-leucopelargonidin * smiles: ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o) *...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ18863 ==
+
== Metabolite LEUCOPELARGONIDIN-CMPD ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** (2r,3s,4s)-leucopelargonidin
−
* right-end-position:
+
* smiles:
−
** 98043
+
** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o)
−
* left-end-position:
+
* inchi-key:
−
** 74801
+
** fsvmlwolzhgcqx-souvjxgzsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 31.829807   
+
** 290.272
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
−
* [[DIHYDRODIPICSYN-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=(2r,3s,4s)-leucopelargonidin}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=fsvmlwolzhgcqx-souvjxgzsa-n}}
−
== Pathway(s) associated ==
+
{{#set: molecular-weight=290.272}}
−
* [[PWY-5097]]
 
−
** '''7''' reactions found over '''7''' reactions in the full pathway
 
−
* [[DAPLYSINESYN-PWY]]
 
−
** '''7''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-2941]]
 
−
** '''6''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-2942]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=98043}}
 
−
{{#set: left-end-position=74801}}
 
−
{{#set: centisome-position=31.829807    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:34, 18 December 2020

Metabolite LEUCOPELARGONIDIN-CMPD

  • common-name:
    • (2r,3s,4s)-leucopelargonidin
  • smiles:
    • c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o)
  • inchi-key:
    • fsvmlwolzhgcqx-souvjxgzsa-n
  • molecular-weight:
    • 290.272

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Triacylglycerides&oldid=47312"