|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETATE--COA-LIGASE-RXN ACETATE--COA-LIGASE-RXN] == | + | == Metabolite 5-HYDROXYISOURATE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** acetate-coa ligase | + | ** (s)-5-hydroxyisourate |
| − | ** acetyl-coa synthetase (amp-forming)
| + | * smiles: |
| − | * ec-number: | + | ** c2(c1(o)(nc(=o)nc1=nc(=o)n2))(=o) |
| − | ** [http://enzyme.expasy.org/EC/6.2.1.1 ec-6.2.1.1] | + | * inchi-key: |
| − | == Reaction formula == | + | ** ltqypavlayvktk-yfkpbyrvsa-n |
| − | * 1 [[ACET]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[ACETYL-COA]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] | + | * molecular-weight: |
| − | == Gene(s) associated with this reaction ==
| + | ** 184.111 |
| − | * Gene: [[SJ08601]]
| + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]] | + | * [[3.5.2.17-RXN]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[orthology]] | + | * [[URATE-OXIDASE-RXN]] |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=(s)-5-hydroxyisourate}} |
| − | * Gene: [[SJ16901]]
| + | {{#set: inchi-key=inchikey=ltqypavlayvktk-yfkpbyrvsa-n}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=184.111}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | * [[PWY0-1313]], acetate conversion to acetyl-CoA: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1313 PWY0-1313]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[PWY-6672]], cis-genanyl-CoA degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6672 PWY-6672]
| |
| − | ** '''4''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY66-21]], ethanol degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-21 PWY66-21] | |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY66-161]], ethanol degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-161 PWY66-161]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-7118]], chitin degradation to ethanol: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7118 PWY-7118]
| |
| − | ** '''5''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY66-162]], ethanol degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-162 PWY66-162]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23176 23176]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00235 R00235]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P27095 P27095]
| |
| − | ** [http://www.uniprot.org/uniprot/P31638 P31638]
| |
| − | ** [http://www.uniprot.org/uniprot/Q12662 Q12662]
| |
| − | ** [http://www.uniprot.org/uniprot/P28812 P28812]
| |
| − | ** [http://www.uniprot.org/uniprot/P27550 P27550]
| |
| − | ** [http://www.uniprot.org/uniprot/O34613 O34613]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PMD2 Q9PMD2]
| |
| − | ** [http://www.uniprot.org/uniprot/P36333 P36333]
| |
| − | ** [http://www.uniprot.org/uniprot/Q01574 Q01574]
| |
| − | ** [http://www.uniprot.org/uniprot/P39062 P39062]
| |
| − | ** [http://www.uniprot.org/uniprot/Q01576 Q01576]
| |
| − | ** [http://www.uniprot.org/uniprot/P52910 P52910]
| |
| − | ** [http://www.uniprot.org/uniprot/Q55404 Q55404]
| |
| − | ** [http://www.uniprot.org/uniprot/P16928 P16928]
| |
| − | ** [http://www.uniprot.org/uniprot/P16929 P16929]
| |
| − | ** [http://www.uniprot.org/uniprot/O68040 O68040]
| |
| − | ** [http://www.uniprot.org/uniprot/P78773 P78773]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=acetyl-coa synthetase (amp-forming)|acetate-coa ligase}} | |
| − | {{#set: ec-number=ec-6.2.1.1}} | |
| − | {{#set: nb gene associated=2}} | |
| − | {{#set: nb pathway associated=6}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
| |
