Difference between revisions of "CPD-13700"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14492 RXN-14492] == * direction: ** left-to-right * common-name: ** 3-oxo-lesqueroloyl-coa synt...")
(Created page with "Category:metabolite == Metabolite CPD1F-114 == * common-name: ** all-trans-lycopene * smiles: ** cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c * in...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14492 RXN-14492] ==
+
== Metabolite CPD1F-114 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 3-oxo-lesqueroloyl-coa synthase
+
** all-trans-lycopene
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.1.199 ec-2.3.1.199]
+
** cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-15364]][c] '''+''' 1 [[MALONYL-COA]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CPD-15368]][c]
+
** oaijszizwzsqbc-gyzmgtaesa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ19629]]
+
** 536.882
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN1F-150]]
−
* Gene: [[SJ00613]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-8042]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ11672]]
+
{{#set: common-name=all-trans-lycopene}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=oaijszizwzsqbc-gyzmgtaesa-n}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=536.882}}
−
* Gene: [[SJ06616]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-6433]], hydroxylated fatty acid biosynthesis (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6433 PWY-6433]
 
−
** '''17''' reactions found over '''22''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=3-oxo-lesqueroloyl-coa synthase}}
 
−
{{#set: ec-number=ec-2.3.1.199}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD1F-114

  • common-name:
    • all-trans-lycopene
  • smiles:
    • cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c
  • inchi-key:
    • oaijszizwzsqbc-gyzmgtaesa-n
  • molecular-weight:
    • 536.882

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-13700&oldid=47571"