|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PEPCARBOXYKIN-RXN PEPCARBOXYKIN-RXN] == | + | == Metabolite CPD-20012 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** phosphoenolpyruvate carboxykinase (atp) | + | ** naringenin chalcone |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/4.1.1.49 ec-4.1.1.49] | + | ** c2(c(c=cc(c1(c(=cc(=cc(o)=1)o)o))=o)=cc=c(c=2)o) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 1 [[OXALACETIC_ACID]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[PHOSPHO-ENOL-PYRUVATE]][c]
| + | ** yqhmwtpyorbcmf-zzxkwvifsa-n |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ14668]] | + | ** 272.257 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[APIGNAR-RXN]] |
| − | ** Category: [[orthology]] | + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[NARINGENIN-CHALCONE-SYNTHASE-RXN]] |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=naringenin chalcone}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: inchi-key=inchikey=yqhmwtpyorbcmf-zzxkwvifsa-n}} |
| − | == Pathway(s) == | + | {{#set: molecular-weight=272.257}} |
| − | * [[PWY-7117]], C4 photosynthetic carbon assimilation cycle, PEPCK type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7117 PWY-7117] | |
| − | ** '''10''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[PWY-561]], superpathway of glyoxylate cycle and fatty acid degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-561 PWY-561]
| |
| − | ** '''6''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[GLUCONEO-PWY]], gluconeogenesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLUCONEO-PWY GLUCONEO-PWY] | |
| − | ** '''12''' reactions found over '''13''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18618 18618]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00341 R00341]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P10963 P10963]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PP01 Q9PP01]
| |
| − | ** [http://www.uniprot.org/uniprot/P43923 P43923]
| |
| − | ** [http://www.uniprot.org/uniprot/P22259 P22259]
| |
| − | ** [http://www.uniprot.org/uniprot/P42066 P42066]
| |
| − | ** [http://www.uniprot.org/uniprot/P49292 P49292]
| |
| − | ** [http://www.uniprot.org/uniprot/O49547 O49547]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9T074 Q9T074]
| |
| − | ** [http://www.uniprot.org/uniprot/Q39294 Q39294]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9RC49 Q9RC49]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=phosphoenolpyruvate carboxykinase (atp)}} | |
| − | {{#set: ec-number=ec-4.1.1.49}} | |
| − | {{#set: nb gene associated=1}} | |
| − | {{#set: nb pathway associated=3}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana|saccharina_japonica_genome|output_pantograph_nannochloropsis_salina}}
| |
