Difference between revisions of "CPD-1084"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12459 RXN-12459] == * direction: ** left-to-right * common-name: ** trna (guanine9-n1)-methyltr...")
(Created page with "Category:metabolite == Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE == * common-name: ** 3,4-dihydroxyphenylglycolaldehyde * smiles: ** c(=o)c(o)c1(c=cc(o)=c(o)c=1) * inchi-ke...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12459 RXN-12459] ==
+
== Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** trna (guanine9-n1)-methyltransferase
+
** 3,4-dihydroxyphenylglycolaldehyde
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.1.1.221 ec-2.1.1.221]
+
** c(=o)c(o)c1(c=cc(o)=c(o)c=1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Guanine9-in-tRNA]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[tRNA-Containing-N1-Methylguanine-9]][c]
+
** yugmcljiwgekck-qmmmgpobsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ03221]]
+
** 168.149
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-10911]]
−
* Gene: [[SJ12164]]
+
* [[RXN-10912]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-10907]]
−
== Pathway(s) ==
+
* [[RXN-10908]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3,4-dihydroxyphenylglycolaldehyde}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=yugmcljiwgekck-qmmmgpobsa-n}}
−
* RHEA:
+
{{#set: molecular-weight=168.149}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=43157 43157]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=trna (guanine9-n1)-methyltransferase}}
 
−
{{#set: ec-number=ec-2.1.1.221}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE

  • common-name:
    • 3,4-dihydroxyphenylglycolaldehyde
  • smiles:
    • c(=o)c(o)c1(c=cc(o)=c(o)c=1)
  • inchi-key:
    • yugmcljiwgekck-qmmmgpobsa-n
  • molecular-weight:
    • 168.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-1084&oldid=47803"