Difference between revisions of "CPD-649"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.8.5.1-RXN 1.8.5.1-RXN] == * direction: ** left-to-right * common-name: ** dehydroascorbate reduct...")
(Created page with "Category:metabolite == Metabolite HOMO-CIS-ACONITATE == * common-name: ** cis-homoaconitate * smiles: ** c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-] * inchi-key: ** bjypzfuwwjsak...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.8.5.1-RXN 1.8.5.1-RXN] ==
+
== Metabolite HOMO-CIS-ACONITATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** dehydroascorbate reductase
+
** cis-homoaconitate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.8.5.1 ec-1.8.5.1]
+
** c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 2 [[GLUTATHIONE]][c] '''+''' 1 [[L-DEHYDRO-ASCORBATE]][c] '''=>''' 1 [[ASCORBATE]][c] '''+''' 1 [[OXIDIZED-GLUTATHIONE]][c] '''+''' 1 [[PROTON]][c]
+
** bjypzfuwwjsakc-arjawskdsa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09713]]
+
** 185.113
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[HOMOACONITATE-HYDRATASE-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ21179]]
+
* [[HOMOACONITATE-HYDRATASE-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=cis-homoaconitate}}
−
* Gene: [[SJ16191]]
+
{{#set: inchi-key=inchikey=bjypzfuwwjsakc-arjawskdsa-k}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=185.113}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-6370]], ascorbate recycling (cytosolic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6370 PWY-6370]
 
−
** '''2''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-2261]], ascorbate glutathione cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2261 PWY-2261]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24425 24425]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R01108 R01108]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/Q7M0D1 Q7M0D1]
 
−
** [http://www.uniprot.org/uniprot/Q9T2H6 Q9T2H6]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=dehydroascorbate reductase}}
 
−
{{#set: ec-number=ec-1.8.5.1}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome|output_pantograph_nannochloropsis_salina}}
 

Revision as of 20:36, 18 December 2020

Metabolite HOMO-CIS-ACONITATE

  • common-name:
    • cis-homoaconitate
  • smiles:
    • c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-]
  • inchi-key:
    • bjypzfuwwjsakc-arjawskdsa-k
  • molecular-weight:
    • 185.113

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-649&oldid=47826"