Difference between revisions of "OLEATE-CPD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14073 RXN-14073] == * direction: ** left-to-right * common-name: ** glycerophosphoglycerol phos...")
(Created page with "Category:metabolite == Metabolite CPD-488 == * common-name: ** β-l-fucose 1-phosphate * smiles: ** cc1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** ptvxqarclqpg...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14073 RXN-14073] ==
+
== Metabolite CPD-488 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** glycerophosphoglycerol phosphodiesterase
+
** β-l-fucose 1-phosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.1.4.46 ec-3.1.4.46]
+
** cc1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[GLYCEROPHOSPHOGLYCEROL]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[GLYCEROL]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''+''' 1 [[PROTON]][c]
+
** ptvxqarclqpgir-sxuwkvjysa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ16458]]
+
** 242.122
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
** Category: [[orthology]]
+
* [[FUCOKINASE-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ00999]]
+
{{#set: common-name=β-l-fucose 1-phosphate}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=ptvxqarclqpgir-sxuwkvjysa-l}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=242.122}}
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29910 29910]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=glycerophosphoglycerol phosphodiesterase}}
 
−
{{#set: ec-number=ec-3.1.4.46}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-488

  • common-name:
    • β-l-fucose 1-phosphate
  • smiles:
    • cc1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
  • inchi-key:
    • ptvxqarclqpgir-sxuwkvjysa-l
  • molecular-weight:
    • 242.122

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=OLEATE-CPD&oldid=47863"