Difference between revisions of "CPD-14950"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE-TRANSAMINE-RXN PREPHENATE-TRANSAMINE-RXN] == * direction: ** reversible * common-name: *...")
(Created page with "Category:metabolite == Metabolite CPD-15663 == * common-name: ** 2-trans-nonenoyl-coa * smiles: ** ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE-TRANSAMINE-RXN PREPHENATE-TRANSAMINE-RXN] ==
+
== Metabolite CPD-15663 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** prephenate aminotransferase
+
** 2-trans-nonenoyl-coa
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.6.1.79 ec-2.6.1.79]
+
** ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[CPD-659]][c] '''<=>''' 1 [[GLT]][c] '''+''' 1 [[PREPHENATE]][c]
+
** hblotzdypzazle-owqwvslfsa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ05778]]
+
** 901.711
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-14794]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-3461]], L-tyrosine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3461 PWY-3461]
+
* [[RXN-14793]]
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-6120]], L-tyrosine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6120 PWY-6120]
+
{{#set: common-name=2-trans-nonenoyl-coa}}
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=hblotzdypzazle-owqwvslfsa-j}}
−
* [[PWY-3462]], L-phenylalanine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3462 PWY-3462]
+
{{#set: molecular-weight=901.711}}
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22880 22880]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07276 R07276]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=prephenate aminotransferase}}
 
−
{{#set: ec-number=ec-2.6.1.79}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=3}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-15663

  • common-name:
    • 2-trans-nonenoyl-coa
  • smiles:
    • ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • hblotzdypzazle-owqwvslfsa-j
  • molecular-weight:
    • 901.711

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-14950&oldid=47899"