Difference between revisions of "Oxo-glutarate-dehydrogenase-lipoyl"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.16.6-RXN 3.4.16.6-RXN] == * direction: ** left-to-right * common-name: ** carboxypeptidase d *...")
(Created page with "Category:metabolite == Metabolite 2-ALPHA-HYDROXYETHYL-THPP == * common-name: ** 2-(α-hydroxyethyl)thiamine diphosphate * smiles: ** cc2(=c(sc(c(c)o)=[n+](cc1(c=nc(c...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.16.6-RXN 3.4.16.6-RXN] ==
+
== Metabolite 2-ALPHA-HYDROXYETHYL-THPP ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** carboxypeptidase d
+
** 2-(α-hydroxyethyl)thiamine diphosphate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/3.4.16.6 ec-3.4.16.6]
+
** cc2(=c(sc(c(c)o)=[n+](cc1(c=nc(c)=nc(n)=1))2)ccop(=o)([o-])op(=o)([o-])[o-])
== Reaction formula ==
+
* inchi-key:
* 1 [[General-Protein-Substrates]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Basic-Amino-Acids]][c] '''+''' 1 [[General-Protein-Substrates]][c]
+
** rruvjgasjonmdy-uhfffaoysa-l
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ12286]]
+
** 466.341
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[PDHam2hi]]
* Gene: [[SJ12659]]
+
* [[PDHam2mi]]
** Category: [[annotation]]
+
* [[RXN-12508]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-14037]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
== Reconstruction information  ==
+
* [[RXN-12583]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14037]]
== External links  ==
+
== Reaction(s) of unknown directionality ==
{{#set: direction=left-to-right}}
+
{{#set: common-name=2-(α-hydroxyethyl)thiamine diphosphate}}
{{#set: common-name=carboxypeptidase d}}
+
{{#set: inchi-key=inchikey=rruvjgasjonmdy-uhfffaoysa-l}}
{{#set: ec-number=ec-3.4.16.6}}
+
{{#set: molecular-weight=466.341}}
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite 2-ALPHA-HYDROXYETHYL-THPP

  • common-name:
    • 2-(α-hydroxyethyl)thiamine diphosphate
  • smiles:
    • cc2(=c(sc(c(c)o)=[n+](cc1(c=nc(c)=nc(n)=1))2)ccop(=o)([o-])op(=o)([o-])[o-])
  • inchi-key:
    • rruvjgasjonmdy-uhfffaoysa-l
  • molecular-weight:
    • 466.341

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality