Difference between revisions of "Oxo-glutarate-dehydrogenase-lipoyl"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.16.6-RXN 3.4.16.6-RXN] == * direction: ** left-to-right * common-name: ** carboxypeptidase d *...") |
(Created page with "Category:metabolite == Metabolite 2-ALPHA-HYDROXYETHYL-THPP == * common-name: ** 2-(α-hydroxyethyl)thiamine diphosphate * smiles: ** cc2(=c(sc(c(c)o)=[n+](cc1(c=nc(c...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 2-ALPHA-HYDROXYETHYL-THPP == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 2-(α-hydroxyethyl)thiamine diphosphate |
− | * | + | * smiles: |
− | ** [ | + | ** cc2(=c(sc(c(c)o)=[n+](cc1(c=nc(c)=nc(n)=1))2)ccop(=o)([o-])op(=o)([o-])[o-]) |
− | == | + | * inchi-key: |
− | + | ** rruvjgasjonmdy-uhfffaoysa-l | |
− | == | + | * molecular-weight: |
− | * | + | ** 466.341 |
− | * | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[PDHam2hi]] |
− | + | * [[PDHam2mi]] | |
− | * | + | * [[RXN-12508]] |
− | + | * [[RXN-14037]] | |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-12583]] | |
− | * | + | * [[RXN-14037]] |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=2-(α-hydroxyethyl)thiamine diphosphate}} | |
− | {{#set: common-name= | + | {{#set: inchi-key=inchikey=rruvjgasjonmdy-uhfffaoysa-l}} |
− | + | {{#set: molecular-weight=466.341}} | |
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:36, 18 December 2020
Contents
Metabolite 2-ALPHA-HYDROXYETHYL-THPP
- common-name:
- 2-(α-hydroxyethyl)thiamine diphosphate
- smiles:
- cc2(=c(sc(c(c)o)=[n+](cc1(c=nc(c)=nc(n)=1))2)ccop(=o)([o-])op(=o)([o-])[o-])
- inchi-key:
- rruvjgasjonmdy-uhfffaoysa-l
- molecular-weight:
- 466.341