Difference between revisions of "CPD-12826"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.27.9-RXN 3.1.27.9-RXN] == * direction: ** left-to-right * common-name: ** trna-splicing endonuc...")
(Created page with "Category:metabolite == Metabolite CPD-9904 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.27.9-RXN 3.1.27.9-RXN] ==
+
== Metabolite CPD-9904 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** trna-splicing endonuclease subunit sen2
+
** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.6.1.16 ec-4.6.1.16]
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD0-2350]][c] '''=>''' 1 [[Pre-tRNA-3-prime-half-molecules]][c] '''+''' 1 [[Pre-tRNA-5-prime-half-molecules]][c] '''+''' 1 [[tRNA-Introns]][c]
+
** kybjqeicwvewil-tuumqracsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ20336]]
+
** 643.968
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ00058]]
+
* [[RXN-9287]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate}}
−
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=kybjqeicwvewil-tuumqracsa-m}}
−
* [[PWY-7803]], tRNA splicing II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7803 PWY-7803]
+
{{#set: molecular-weight=643.968}}
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6689]], tRNA splicing I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6689 PWY-6689]
 
−
** '''2''' reactions found over '''7''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/O07118 O07118]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=trna-splicing endonuclease subunit sen2}}
 
−
{{#set: ec-number=ec-4.6.1.16}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-9904

  • common-name:
    • 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
  • inchi-key:
    • kybjqeicwvewil-tuumqracsa-m
  • molecular-weight:
    • 643.968

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-12826&oldid=48119"