Difference between revisions of "1-PHOSPHATIDYL-1D-MYO-INOSITOL-5-PHOSPHA"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11520 RXN-11520] == * direction: ** left-to-right == Reaction formula == * 1 1-7-DIMETHYLXANT...") |
(Created page with "Category:metabolite == Metabolite CPD-2961 == * common-name: ** d-gluconate 6-phosphate * smiles: ** c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o * inchi-key: ** birsgzkfk...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-2961 == |
− | * | + | * common-name: |
− | ** | + | ** d-gluconate 6-phosphate |
− | + | * smiles: | |
− | * | + | ** c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o |
− | + | * inchi-key: | |
− | * | + | ** birsgzkfkxlsjq-sqougzdysa-k |
− | ** | + | * molecular-weight: |
− | * | + | ** 273.113 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | + | * [[6PGLUCONDEHYDROG-RXN]] | |
− | * | + | * [[PGLUCONDEHYDRAT-RXN]] |
− | * | + | * [[RXN-3341]] |
− | * | + | * [[RXN-9952]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[6PGLUCONOLACT-RXN]] | |
− | + | * [[GLUCONOKIN-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=d-gluconate 6-phosphate}} | |
− | == | + | {{#set: inchi-key=inchikey=birsgzkfkxlsjq-sqougzdysa-k}} |
− | * [[ | + | {{#set: molecular-weight=273.113}} |
− | * | ||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:37, 18 December 2020
Contents
Metabolite CPD-2961
- common-name:
- d-gluconate 6-phosphate
- smiles:
- c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o
- inchi-key:
- birsgzkfkxlsjq-sqougzdysa-k
- molecular-weight:
- 273.113