Difference between revisions of "TETRADECANOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17922 RXN-17922] == * direction: ** left-to-right == Reaction formula == * 1 5-Phospho-termin...") |
(Created page with "Category:metabolite == Metabolite PYRIDOXINE-5P == * common-name: ** pyridoxine 5'-phosphate * smiles: ** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co) * inchi-key: ** whomfkwh...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite PYRIDOXINE-5P == |
| − | * | + | * common-name: |
| − | ** | + | ** pyridoxine 5'-phosphate |
| − | == | + | * smiles: |
| − | + | ** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co) | |
| − | == | + | * inchi-key: |
| − | * | + | ** whomfkwhiqzthy-uhfffaoysa-l |
| − | * | + | * molecular-weight: |
| − | + | ** 247.144 | |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[PNPOXI-RXN]] | |
| − | * | + | * [[RXN-14181]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[PNKIN-RXN]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=pyridoxine 5'-phosphate}} | |
| − | {{#set: | + | {{#set: inchi-key=inchikey=whomfkwhiqzthy-uhfffaoysa-l}} |
| − | + | {{#set: molecular-weight=247.144}} | |
| − | |||
| − | |||
Revision as of 20:37, 18 December 2020
Contents
Metabolite PYRIDOXINE-5P
- common-name:
- pyridoxine 5'-phosphate
- smiles:
- cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co)
- inchi-key:
- whomfkwhiqzthy-uhfffaoysa-l
- molecular-weight:
- 247.144
