Difference between revisions of "Crotonyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PLASMALOGEN-SYNTHASE-RXN PLASMALOGEN-SYNTHASE-RXN] == * direction: ** reversible * common-name: **...")
(Created page with "Category:metabolite == Metabolite GLC == * common-name: ** β-d-glucopyranose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-vfuothlcsa-n * mol...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PLASMALOGEN-SYNTHASE-RXN PLASMALOGEN-SYNTHASE-RXN] ==
+
== Metabolite GLC ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** plasmalogen synthase
+
** β-d-glucopyranose
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.3.1.25 ec-2.3.1.25]
+
** c(o)c1(oc(o)c(o)c(o)c(o)1)
== Reaction formula ==
+
* inchi-key:
* 1 [[ACYL-COA]][c] '''+''' 1 [[CPD-563]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[PLASMENYLCHOLINE]][c]
+
** wqzgkkkjijffok-vfuothlcsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ22477]]
+
** 180.157
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[ALDOSE-1-EPIMERASE-RXN]]
== Pathway(s) ==
+
* [[GLUCISOM-RXN-GLC//CPD-15382.15.]]
== Reconstruction information  ==
+
* [[biomass_rxn]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
== External links  ==
+
* [[3.2.1.106-RXN]]
* RHEA:
+
* [[ALDOSE-1-EPIMERASE-RXN]]
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10344 10344]
+
* [[GLUCISOM-RXN-GLC//CPD-15382.15.]]
* LIGAND-RXN:
+
* [[TREHALA-RXN]]
** [http://www.genome.jp/dbget-bin/www_bget?R03109 R03109]
+
== Reaction(s) of unknown directionality ==
{{#set: direction=reversible}}
+
{{#set: common-name=&beta;-d-glucopyranose}}
{{#set: common-name=plasmalogen synthase}}
+
{{#set: inchi-key=inchikey=wqzgkkkjijffok-vfuothlcsa-n}}
{{#set: ec-number=ec-2.3.1.25}}
+
{{#set: molecular-weight=180.157}}
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite GLC

  • common-name:
    • β-d-glucopyranose
  • smiles:
    • c(o)c1(oc(o)c(o)c(o)c(o)1)
  • inchi-key:
    • wqzgkkkjijffok-vfuothlcsa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality