Difference between revisions of "S-ubiquitinyl-HECT-E3-UCP-L-cysteine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.1.1.81-RXN 4.1.1.81-RXN] == * direction: ** left-to-right * common-name: ** threonine-phosphate d...")
(Created page with "Category:metabolite == Metabolite PRISTANATE == * common-name: ** pristanate * smiles: ** cc(cccc(cccc(c)cccc(c([o-])=o)c)c)c * inchi-key: ** pahgjzdqxioyth-uhfffaoysa-m *...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.1.1.81-RXN 4.1.1.81-RXN] ==
+
== Metabolite PRISTANATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** threonine-phosphate decarboxylase
+
** pristanate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.1.1.81 ec-4.1.1.81]
+
** cc(cccc(cccc(c)cccc(c([o-])=o)c)c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[L-THREONINE-O-3-PHOSPHATE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[R-1-AMINOPROPAN-2-YL-PHOSPHATE]][c]
+
** pahgjzdqxioyth-uhfffaoysa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ11200]]
+
** 297.5
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN66-484]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-5443]], aminopropanol phosphate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5443 PWY-5443]
+
== Reaction(s) of unknown directionality ==
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
{{#set: common-name=pristanate}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=pahgjzdqxioyth-uhfffaoysa-m}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=297.5}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11493 11493]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R06530 R06530]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=threonine-phosphate decarboxylase}}
 
−
{{#set: ec-number=ec-4.1.1.81}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite PRISTANATE

  • common-name:
    • pristanate
  • smiles:
    • cc(cccc(cccc(c)cccc(c([o-])=o)c)c)c
  • inchi-key:
    • pahgjzdqxioyth-uhfffaoysa-m
  • molecular-weight:
    • 297.5

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=S-ubiquitinyl-HECT-E3-UCP-L-cysteine&oldid=48290"