Difference between revisions of "CPD-15279"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17920 RXN-17920] == * direction: ** left-to-right == Reaction formula == * 1 DNA-Ligase-L-lys...")
(Created page with "Category:metabolite == Metabolite CPD0-2184 == * common-name: ** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate * smiles: ** c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17920 RXN-17920] ==
+
== Metabolite CPD0-2184 ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate
−
== Reaction formula ==
+
* smiles:
−
* 1 [[DNA-Ligase-L-lysine]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[DNA-Ligase-L-lysine-adenylate]][c] '''+''' 1 [[NICOTINAMIDE_NUCLEOTIDE]][c] '''+''' 2 [[PROTON]][c]
+
** c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ19344]]
+
** wcjyzufkktynlb-aritwgjrsa-l
−
** Category: [[annotation]]
+
* molecular-weight:
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 210.143
−
* Gene: [[SJ15543]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN-12070]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=(2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=wcjyzufkktynlb-aritwgjrsa-l}}
−
== External links  ==
+
{{#set: molecular-weight=210.143}}
−
{{#set: direction=left-to-right}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD0-2184

  • common-name:
    • (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate
  • smiles:
    • c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o
  • inchi-key:
    • wcjyzufkktynlb-aritwgjrsa-l
  • molecular-weight:
    • 210.143

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-15279&oldid=48308"