Difference between revisions of "CPD-2742"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8675 RXN-8675] == * direction: ** left-to-right * common-name: ** s-adenosyl-l-methionine:preco...") |
(Created page with "Category:metabolite == Metabolite CPD-14422 == * common-name: ** 3-oxo-icosatrienoyl-coa * smiles: ** ccc=ccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-14422 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 3-oxo-icosatrienoyl-coa |
− | * | + | * smiles: |
− | ** | + | ** ccc=ccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
− | + | * inchi-key: | |
− | + | ** dfyfqqxxtclfng-ubqhhbpxsa-j | |
− | + | * molecular-weight: | |
− | + | ** 1065.958 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN-12994]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-13441]] |
− | + | == Reaction(s) of unknown directionality == | |
− | = | + | {{#set: common-name=3-oxo-icosatrienoyl-coa}} |
− | + | {{#set: inchi-key=inchikey=dfyfqqxxtclfng-ubqhhbpxsa-j}} | |
− | + | {{#set: molecular-weight=1065.958}} | |
− | |||
− | |||
− | |||
− | = | ||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | * | ||
− | |||
− | ** | ||
− | == | ||
− | * | ||
− | |||
− | == | ||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Revision as of 20:37, 18 December 2020
Contents
Metabolite CPD-14422
- common-name:
- 3-oxo-icosatrienoyl-coa
- smiles:
- ccc=ccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- dfyfqqxxtclfng-ubqhhbpxsa-j
- molecular-weight:
- 1065.958