|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8675 RXN-8675] == | + | == Metabolite CPD-14422 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** s-adenosyl-l-methionine:precorrin-1 c-methyltransferase | + | ** 3-oxo-icosatrienoyl-coa |
| − | * synonymous: | + | * smiles: |
| − | ** uroporphyrinogen methyltransferase | + | ** ccc=ccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | ** uroporphyrin-iii c-methyltransferase (incorrect)
| + | * inchi-key: |
| − | ** sira
| + | ** dfyfqqxxtclfng-ubqhhbpxsa-j |
| − | ** cysg
| + | * molecular-weight: |
| − | ** s-adenosyl-l-methionine:uroporphyrin-iii c-methyltransferase (incorrect)
| + | ** 1065.958 |
| − | ** s-adenosyl-l-methionine-dependent uroporphyrinogen iii methylase
| + | == Reaction(s) known to consume the compound == |
| − | ** adenosylmethionine-uroporphyrinogen iii methyltransferase
| + | * [[RXN-12994]] |
| − | ** uroporphyrinogen-iii methyltransferase
| + | == Reaction(s) known to produce the compound == |
| − | == Reaction formula == | + | * [[RXN-13441]] |
| − | * 1 [[CPD-9038]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[DIHYDROSIROHYDROCHLORIN]][c]
| + | == Reaction(s) of unknown directionality == |
| − | == Gene(s) associated with this reaction == | + | {{#set: common-name=3-oxo-icosatrienoyl-coa}} |
| − | * Gene: [[SJ12313]]
| + | {{#set: inchi-key=inchikey=dfyfqqxxtclfng-ubqhhbpxsa-j}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=1065.958}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | * [[PWY-7376]], cob(II)yrinate a,c-diamide biosynthesis II (late cobalt incorporation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7376 PWY-7376]
| |
| − | ** '''2''' reactions found over '''13''' reactions in the full pathway | |
| − | * [[PWY-7377]], cob(II)yrinate a,c-diamide biosynthesis I (early cobalt insertion): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7377 PWY-7377]
| |
| − | ** '''4''' reactions found over '''15''' reactions in the full pathway | |
| − | * [[PWY-5196]], factor 430 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5196 PWY-5196]
| |
| − | ** '''3''' reactions found over '''7''' reactions in the full pathway | |
| − | * [[PWY-5194]], siroheme biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5194 PWY-5194]
| |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway | |
| − | == Reconstruction information == | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA: | |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21973 21973]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R07238 R07238]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=s-adenosyl-l-methionine:precorrin-1 c-methyltransferase}} | |
| − | {{#set: synonymous=uroporphyrinogen methyltransferase|s-adenosyl-l-methionine-dependent uroporphyrinogen iii methylase|s-adenosyl-l-methionine:uroporphyrin-iii c-methyltransferase (incorrect)|sira|uroporphyrinogen-iii methyltransferase|uroporphyrin-iii c-methyltransferase (incorrect)|adenosylmethionine-uroporphyrinogen iii methyltransferase|cysg}} | |
| − | {{#set: nb gene associated=1}} | |
| − | {{#set: nb pathway associated=4}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
