Difference between revisions of "BETAINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13334 RXN-13334] == * direction: ** left-to-right * common-name: ** phosphatidylinositol phosph...")
(Created page with "Category:metabolite == Metabolite S-HYDROXYMETHYLGLUTATHIONE == * common-name: ** s-(hydroxymethyl)glutathione * smiles: ** c(nc(=o)c(csco)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13334 RXN-13334] ==
+
== Metabolite S-HYDROXYMETHYLGLUTATHIONE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** phosphatidylinositol phospholipase c
+
** s-(hydroxymethyl)glutathione
−
** phosphatidylinositol 4-phosphate phospholipase c
+
* smiles:
−
* ec-number:
+
** c(nc(=o)c(csco)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-]
−
** [http://enzyme.expasy.org/EC/3.1.4.11 ec-3.1.4.11]
+
* inchi-key:
−
== Reaction formula ==
+
** piuslwsyoyfrfr-bqbzgakwsa-m
−
* 1 [[CPD-1108]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[DIACYLGLYCEROL]][c] '''+''' 1 [[INOSITOL-1-4-BISPHOSPHATE]][c] '''+''' 1 [[PROTON]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 336.339
−
* Gene: [[SJ20221]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN-2962]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN0-276]]
−
* Gene: [[SJ16244]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN0-276]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=s-(hydroxymethyl)glutathione}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=piuslwsyoyfrfr-bqbzgakwsa-m}}
−
* Gene: [[SJ16245]]
+
{{#set: molecular-weight=336.339}}
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=phosphatidylinositol 4-phosphate phospholipase c|phosphatidylinositol phospholipase c}}
 
−
{{#set: ec-number=ec-3.1.4.11}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite S-HYDROXYMETHYLGLUTATHIONE

  • common-name:
    • s-(hydroxymethyl)glutathione
  • smiles:
    • c(nc(=o)c(csco)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-]
  • inchi-key:
    • piuslwsyoyfrfr-bqbzgakwsa-m
  • molecular-weight:
    • 336.339

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=BETAINE&oldid=48468"