Difference between revisions of "CPD-13401"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=LEUKOTRIENE-C4-SYNTHASE-RXN LEUKOTRIENE-C4-SYNTHASE-RXN] == * direction: ** left-to-right * common-...")
(Created page with "Category:metabolite == Metabolite CPD-12677 == * common-name: ** 5-chloro-5-deoxyribose 1-phosphate * smiles: ** c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1) * inchi-key: ** dgv...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=LEUKOTRIENE-C4-SYNTHASE-RXN LEUKOTRIENE-C4-SYNTHASE-RXN] ==
+
== Metabolite CPD-12677 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** leukotriene-c4 synthase
+
** 5-chloro-5-deoxyribose 1-phosphate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/4.4.1.20 ec-4.4.1.20]
+
** c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1)
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-8892]][c] '''+''' 1 [[GLUTATHIONE]][c] '''=>''' 1 [[LEUKOTRIENE-C4]][c]
+
** dgviesznpvjdpq-soofdhnksa-l
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ14909]]
+
** 246.541
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
== Pathway(s) ==
+
* [[RXN-11715]]
* [[PWY66-375]], leukotriene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-375 PWY66-375]
+
== Reaction(s) of unknown directionality ==
** '''5''' reactions found over '''6''' reactions in the full pathway
+
{{#set: common-name=5-chloro-5-deoxyribose 1-phosphate}}
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=dgviesznpvjdpq-soofdhnksa-l}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=246.541}}
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17619 17619]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R03059 R03059]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/Q16873 Q16873]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=leukotriene-c4 synthase}}
 
{{#set: ec-number=ec-4.4.1.20}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:38, 18 December 2020

Metabolite CPD-12677

  • common-name:
    • 5-chloro-5-deoxyribose 1-phosphate
  • smiles:
    • c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1)
  • inchi-key:
    • dgviesznpvjdpq-soofdhnksa-l
  • molecular-weight:
    • 246.541

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality