Difference between revisions of "3-Phosphopolynucleotides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=URKI-RXN URKI-RXN] == * direction: ** left-to-right * common-name: ** gtp:uridine 5'-phosphotransfe...")
(Created page with "Category:metabolite == Metabolite CPD-676 == * common-name: ** trans-caffeate * smiles: ** c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1) * inchi-key: ** qaiprvgongvqas-duxpyhpusa-m *...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=URKI-RXN URKI-RXN] ==
+
== Metabolite CPD-676 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** gtp:uridine 5'-phosphotransferase
+
** trans-caffeate
−
** uridine kinase
+
* smiles:
−
* ec-number:
+
** c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1)
−
** [http://enzyme.expasy.org/EC/2.7.1.48 ec-2.7.1.48]
+
* inchi-key:
−
== Reaction formula ==
+
** qaiprvgongvqas-duxpyhpusa-m
−
* 1 [[GTP]][c] '''+''' 1 [[URIDINE]][c] '''=>''' 1 [[GDP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[UMP]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 179.152
−
* Gene: [[SJ02034]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN-1104]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-1126]]
−
* Gene: [[SJ16689]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: common-name=trans-caffeate}}
−
* Gene: [[SJ06565]]
+
{{#set: inchi-key=inchikey=qaiprvgongvqas-duxpyhpusa-m}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=179.152}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ15690]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27650 27650]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R00968 R00968]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/P0A8F4 P0A8F4]
 
−
** [http://www.uniprot.org/uniprot/P47622 P47622]
 
−
** [http://www.uniprot.org/uniprot/Q9CF21 Q9CF21]
 
−
** [http://www.uniprot.org/uniprot/P44533 P44533]
 
−
** [http://www.uniprot.org/uniprot/P27515 P27515]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=uridine kinase|gtp:uridine 5'-phosphotransferase}}
 
−
{{#set: ec-number=ec-2.7.1.48}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:38, 18 December 2020

Metabolite CPD-676

  • common-name:
    • trans-caffeate
  • smiles:
    • c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1)
  • inchi-key:
    • qaiprvgongvqas-duxpyhpusa-m
  • molecular-weight:
    • 179.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-Phosphopolynucleotides&oldid=48563"