Difference between revisions of "CPD-4"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14148 RXN-14148] == * direction: ** reversible * common-name: ** 1d-chiro-inositol 1-dehydrogen...") |
(Created page with "Category:metabolite == Metabolite CPD-5923 == * common-name: ** 5'-deoxy-5'-fluoroadenosine * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))f * inchi-key: ** qp...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-5923 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 5'-deoxy-5'-fluoroadenosine |
− | * | + | * smiles: |
− | ** | + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))f |
− | + | * inchi-key: | |
− | + | ** qpvlkmicbyrpsx-kqynxxcusa-n | |
− | == | + | * molecular-weight: |
− | * | + | ** 269.235 |
− | + | == Reaction(s) known to consume the compound == | |
− | ** | + | * [[RXN-11743]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=5'-deoxy-5'-fluoroadenosine}} | |
− | * | + | {{#set: inchi-key=inchikey=qpvlkmicbyrpsx-kqynxxcusa-n}} |
− | + | {{#set: molecular-weight=269.235}} | |
− | |||
− | |||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | == | ||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Revision as of 20:38, 18 December 2020
Contents
Metabolite CPD-5923
- common-name:
- 5'-deoxy-5'-fluoroadenosine
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))f
- inchi-key:
- qpvlkmicbyrpsx-kqynxxcusa-n
- molecular-weight:
- 269.235