Difference between revisions of "CPD-4"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14148 RXN-14148] == * direction: ** reversible * common-name: ** 1d-chiro-inositol 1-dehydrogen...")
(Created page with "Category:metabolite == Metabolite CPD-5923 == * common-name: ** 5'-deoxy-5'-fluoroadenosine * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))f * inchi-key: ** qp...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14148 RXN-14148] ==
+
== Metabolite CPD-5923 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** 1d-chiro-inositol 1-dehydrogenase
+
** 5'-deoxy-5'-fluoroadenosine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.1.369 ec-1.1.1.369]
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))f
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-8052]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[CPD-365]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c]
+
** qpvlkmicbyrpsx-kqynxxcusa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09024]]
+
** 269.235
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-11743]]
−
* Gene: [[SJ04575]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=5'-deoxy-5'-fluoroadenosine}}
−
* Gene: [[SJ21896]]
+
{{#set: inchi-key=inchikey=qpvlkmicbyrpsx-kqynxxcusa-n}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=269.235}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ14768]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-7237]], myo-, chiro- and scyllo-inositol degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7237 PWY-7237]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R09951 R09951]
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25835 25835]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=1d-chiro-inositol 1-dehydrogenase}}
 
−
{{#set: ec-number=ec-1.1.1.369}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:38, 18 December 2020

Metabolite CPD-5923

  • common-name:
    • 5'-deoxy-5'-fluoroadenosine
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))f
  • inchi-key:
    • qpvlkmicbyrpsx-kqynxxcusa-n
  • molecular-weight:
    • 269.235

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-4&oldid=48621"