Difference between revisions of "Palmitoleoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12130 == * common-name: ** menaquinol-13 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc...")
(Created page with "Category:metabolite == Metabolite HCO3 == * common-name: ** hydrogencarbonate * smiles: ** c([o-])(=o)o * inchi-key: ** bvkzguzccusvtd-uhfffaoysa-m * molecular-weight: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12130 ==
+
== Metabolite HCO3 ==
 
* common-name:
 
* common-name:
** menaquinol-13
+
** hydrogencarbonate
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c)c
+
** c([o-])(=o)o
 
* inchi-key:
 
* inchi-key:
** zlhyydgaqjjtjl-hwrcdasfsa-n
+
** bvkzguzccusvtd-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 1059.735
+
** 61.017
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 +
* [[BIOTIN-CARBOXYL-RXN]]
 +
* [[CARBPSYN-RXN]]
 +
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 +
* [[PCr]]
 +
* [[PEPCARBOX-RXN]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 +
* [[PYRUVATE-CARBOXYLASE-RXN]]
 +
* [[R524-RXN]]
 +
* [[RXN-12893]]
 +
* [[RXN-13202]]
 +
* [[RXN-14569]]
 +
* [[RXN-16909]]
 +
* [[RXN0-5224]]
 +
* [[RXN1G-4355]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9366]]
+
* [[1.2.1.27-RXN]]
 +
* [[ACOACXr]]
 +
* [[PCr]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 +
* [[RXN-11213]]
 +
* [[RXN-14569]]
 +
* [[RXN0-5224]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=menaquinol-13}}
+
{{#set: common-name=hydrogencarbonate}}
{{#set: inchi-key=inchikey=zlhyydgaqjjtjl-hwrcdasfsa-n}}
+
{{#set: inchi-key=inchikey=bvkzguzccusvtd-uhfffaoysa-m}}
{{#set: molecular-weight=1059.735}}
+
{{#set: molecular-weight=61.017}}

Revision as of 14:53, 5 January 2021