Difference between revisions of "GLUCOSAMINE-1P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-193 == * common-name: ** d-myo-inositol (4,5)-bisphosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1) *...") |
(Created page with "Category:metabolite == Metabolite CPD-14485 == * common-name: ** glycyrrhetaldehyde * smiles: ** cc4(c)(c3(ccc2(c)(c1(c)(ccc5([ch](c1=cc(c2c(c)3ccc(o)4)=o)cc([ch]=o)(c)cc5...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-14485 == |
* common-name: | * common-name: | ||
| − | ** | + | ** glycyrrhetaldehyde |
* smiles: | * smiles: | ||
| − | ** | + | ** cc4(c)(c3(ccc2(c)(c1(c)(ccc5([ch](c1=cc(c2c(c)3ccc(o)4)=o)cc([ch]=o)(c)cc5)c)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** otknpgbtqxvjnh-dfrazxlmsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 454.692 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13494]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13493]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glycyrrhetaldehyde}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=otknpgbtqxvjnh-dfrazxlmsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=454.692}} |
Revision as of 14:53, 5 January 2021
Contents
Metabolite CPD-14485
- common-name:
- glycyrrhetaldehyde
- smiles:
- cc4(c)(c3(ccc2(c)(c1(c)(ccc5([ch](c1=cc(c2c(c)3ccc(o)4)=o)cc([ch]=o)(c)cc5)c))))
- inchi-key:
- otknpgbtqxvjnh-dfrazxlmsa-n
- molecular-weight:
- 454.692
