Difference between revisions of "Carboxyadenylated-MPT-synthases"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-138 == * common-name: ** gibberellin a12-aldehyde * smiles: ** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c=o)))...") |
(Created page with "Category:metabolite == Metabolite 5-DEHYDROGLUCONATE == * common-name: ** 5-dehydro-d-gluconate * smiles: ** c(o)c(=o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** izsrjdgcgrauar-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-DEHYDROGLUCONATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 5-dehydro-d-gluconate |
* smiles: | * smiles: | ||
− | ** c | + | ** c(o)c(=o)c(o)c(o)c(o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** izsrjdgcgrauar-mrozadkfsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 193.133 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[GLUCONATE-5-DEHYDROGENASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12107]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=5-dehydro-d-gluconate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=izsrjdgcgrauar-mrozadkfsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=193.133}} |
Revision as of 14:53, 5 January 2021
Contents
Metabolite 5-DEHYDROGLUCONATE
- common-name:
- 5-dehydro-d-gluconate
- smiles:
- c(o)c(=o)c(o)c(o)c(o)c(=o)[o-]
- inchi-key:
- izsrjdgcgrauar-mrozadkfsa-m
- molecular-weight:
- 193.133