Difference between revisions of "CPD-15656"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYL-6-METHOXYPHENOL == * common-name: ** 2-methoxy-6-(all-trans-octaprenyl)phenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(...")
(Created page with "Category:metabolite == Metabolite CPD-15979 == * common-name: ** d-mannopyranose 6-phosphate == Reaction(s) known to consume the compound == * MANNPISOM-RXN * PHOSMA...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-OCTAPRENYL-6-METHOXYPHENOL ==
+
== Metabolite CPD-15979 ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-(all-trans-octaprenyl)phenol
+
** d-mannopyranose 6-phosphate
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c
 
* inchi-key:
 
** margkpimnmaskj-cmaxttdksa-n
 
* molecular-weight:
 
** 669.085
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[MANNPISOM-RXN]]
 +
* [[PHOSMANMUT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]]
+
* [[MANNKIN-RXN]]
 +
* [[MANNPISOM-RXN]]
 +
* [[PHOSMANMUT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-(all-trans-octaprenyl)phenol}}
+
{{#set: common-name=d-mannopyranose 6-phosphate}}
{{#set: inchi-key=inchikey=margkpimnmaskj-cmaxttdksa-n}}
 
{{#set: molecular-weight=669.085}}
 

Revision as of 14:54, 5 January 2021

Metabolite CPD-15979

  • common-name:
    • d-mannopyranose 6-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality