Difference between revisions of "N-Ac-L-methionyl-L-glutaminyl-Protein"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ASN-tRNAs == * common-name: ** trnaasn == Reaction(s) known to consume the compound == * ASPARAGINE--TRNA-LIGASE-RXN == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite CPD-535 == * common-name: ** β-d-fructose 2,6-bisphosphate * smiles: ** c(c1(oc(c(c1o)o)(co)op([o-])([o-])=o))op(=o)([o-])[o-] * inc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-535 == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-fructose 2,6-bisphosphate |
| + | * smiles: | ||
| + | ** c(c1(oc(c(c1o)o)(co)op([o-])([o-])=o))op(=o)([o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** yxwoajxnvlxpmu-zxxmmsqzsa-j | ||
| + | * molecular-weight: | ||
| + | ** 336.085 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.1.3.46-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[6-PHOSPHOFRUCTO-2-KINASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-fructose 2,6-bisphosphate}} |
| + | {{#set: inchi-key=inchikey=yxwoajxnvlxpmu-zxxmmsqzsa-j}} | ||
| + | {{#set: molecular-weight=336.085}} | ||
Revision as of 14:54, 5 January 2021
Contents
Metabolite CPD-535
- common-name:
- β-d-fructose 2,6-bisphosphate
- smiles:
- c(c1(oc(c(c1o)o)(co)op([o-])([o-])=o))op(=o)([o-])[o-]
- inchi-key:
- yxwoajxnvlxpmu-zxxmmsqzsa-j
- molecular-weight:
- 336.085
