Difference between revisions of "HISTAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17492 == * common-name: ** (r)-2-hydroxy-4-methylpentanoate * smiles: ** cc(c)cc(c([o-])=o)o * inchi-key: ** lvrftazaxqpqhi-rxmqykeds...")
(Created page with "Category:metabolite == Metabolite CPD-15656 == * common-name: ** (3e)-undec-2-enoyl-coa * smiles: ** ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17492 ==
+
== Metabolite CPD-15656 ==
 
* common-name:
 
* common-name:
** (r)-2-hydroxy-4-methylpentanoate
+
** (3e)-undec-2-enoyl-coa
 
* smiles:
 
* smiles:
** cc(c)cc(c([o-])=o)o
+
** ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** lvrftazaxqpqhi-rxmqykedsa-m
+
** cavmkinpgrcurl-phhhidlgsa-j
 
* molecular-weight:
 
* molecular-weight:
** 131.151
+
** 929.765
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14778]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17525]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-2-hydroxy-4-methylpentanoate}}
+
{{#set: common-name=(3e)-undec-2-enoyl-coa}}
{{#set: inchi-key=inchikey=lvrftazaxqpqhi-rxmqykedsa-m}}
+
{{#set: inchi-key=inchikey=cavmkinpgrcurl-phhhidlgsa-j}}
{{#set: molecular-weight=131.151}}
+
{{#set: molecular-weight=929.765}}

Revision as of 14:54, 5 January 2021

Metabolite CPD-15656

  • common-name:
    • (3e)-undec-2-enoyl-coa
  • smiles:
    • ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • cavmkinpgrcurl-phhhidlgsa-j
  • molecular-weight:
    • 929.765

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality