Difference between revisions of "CPD-19144"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12461 == * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)...") |
(Created page with "Category:metabolite == Metabolite CPD-7206 == * common-name: ** 8'-apo-β-carotenal * smiles: ** cc(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)=cc=cc=c(c=cc=c(c=o)c)c * inchi-key:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-7206 == |
+ | * common-name: | ||
+ | ** 8'-apo-β-carotenal | ||
* smiles: | * smiles: | ||
− | ** cc(= | + | ** cc(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)=cc=cc=c(c=cc=c(c=o)c)c |
− | * | + | * inchi-key: |
− | ** | + | ** dfmmvlfmmaqxhz-dokbywhisa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 416.645 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-11783]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=8'-apo-β-carotenal}} |
− | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=dfmmvlfmmaqxhz-dokbywhisa-n}} |
+ | {{#set: molecular-weight=416.645}} |
Revision as of 14:54, 5 January 2021
Contents
Metabolite CPD-7206
- common-name:
- 8'-apo-β-carotenal
- smiles:
- cc(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)=cc=cc=c(c=cc=c(c=o)c)c
- inchi-key:
- dfmmvlfmmaqxhz-dokbywhisa-n
- molecular-weight:
- 416.645