Difference between revisions of "CPD3DJ-82"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LL-DIAMINOPIMELATE == * common-name: ** l,l-diaminopimelate * smiles: ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o * inchi-key: ** gmkmezvlhj...") |
(Created page with "Category:metabolite == Metabolite Keratan-sulfate-NAcGlc == * common-name: ** [keratan sulfate]-α-n-acetyl-d-glucosamine == Reaction(s) known to consume the compound...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Keratan-sulfate-NAcGlc == |
* common-name: | * common-name: | ||
| − | ** | + | ** [keratan sulfate]-α-n-acetyl-d-glucosamine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-11570]] | |
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=[keratan sulfate]-α-n-acetyl-d-glucosamine}} |
| − | |||
| − | |||
Revision as of 14:54, 5 January 2021
Contents
Metabolite Keratan-sulfate-NAcGlc
- common-name:
- [keratan sulfate]-α-n-acetyl-d-glucosamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "keratan sulfate]-α-n-acetyl-d-glucosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
