Difference between revisions of "Oxidized-flavodoxins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13025 == * common-name: ** guanosine 2'-monophosphate * smiles: ** c(o)c1(oc(c(op([o-])(=o)[o-])c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) *...") |
(Created page with "Category:metabolite == Metabolite Oxidized-flavodoxins == * common-name: ** an oxidized flavodoxin == Reaction(s) known to consume the compound == * [[FLAVONADPREDUCT-RXN]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Oxidized-flavodoxins == |
* common-name: | * common-name: | ||
| − | ** | + | ** an oxidized flavodoxin |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[FLAVONADPREDUCT-RXN]] | ||
| + | * [[PYFLAVOXRE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[FLAVONADPREDUCT-RXN]] |
| + | * [[PYFLAVOXRE-RXN]] | ||
| + | * [[RXN-15878]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an oxidized flavodoxin}} |
| − | |||
| − | |||
Revision as of 14:54, 5 January 2021
Contents
Metabolite Oxidized-flavodoxins
- common-name:
- an oxidized flavodoxin
