Difference between revisions of "CPD-560"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE == * common-name: ** 2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine * smiles: ** c(nc=o...") |
(Created page with "Category:metabolite == Metabolite SINAPALDEHYDE == * common-name: ** sinapaldehyde * smiles: ** coc1(c=c(c=cc=o)c=c(oc)c(o)=1) * inchi-key: ** cdicdsogtrchmg-onegzznksa-n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SINAPALDEHYDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** sinapaldehyde |
* smiles: | * smiles: | ||
| − | ** c( | + | ** coc1(c=c(c=cc=o)c=c(oc)c(o)=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cdicdsogtrchmg-onegzznksa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 208.213 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-1124]] |
| + | * [[RXN-1125]] | ||
| + | * [[RXN-8014]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-1124]] |
| + | * [[RXN-1143]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sinapaldehyde}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cdicdsogtrchmg-onegzznksa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=208.213}} |
Revision as of 14:54, 5 January 2021
Contents
Metabolite SINAPALDEHYDE
- common-name:
- sinapaldehyde
- smiles:
- coc1(c=c(c=cc=o)c=c(oc)c(o)=1)
- inchi-key:
- cdicdsogtrchmg-onegzznksa-n
- molecular-weight:
- 208.213
