Difference between revisions of "CPD-9699"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 23S-rRNA-guanine-2069 == * common-name: ** a guanine2069 in 23s rrna == Reaction(s) known to consume the compound == * RXN0-6950 == R...") |
(Created page with "Category:metabolite == Metabolite CPD-13187 == * common-name: ** unsaturated gellan tetrasaccharide * smiles: ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-13187 == |
* common-name: | * common-name: | ||
− | ** | + | ** unsaturated gellan tetrasaccharide |
+ | * smiles: | ||
+ | ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)oc4(oc(c([o-])=o)=cc(o)c(o)4))) | ||
+ | * inchi-key: | ||
+ | ** jmdplhpaglyhci-pqvubfrasa-m | ||
+ | * molecular-weight: | ||
+ | ** 645.544 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12270]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=unsaturated gellan tetrasaccharide}} |
+ | {{#set: inchi-key=inchikey=jmdplhpaglyhci-pqvubfrasa-m}} | ||
+ | {{#set: molecular-weight=645.544}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD-13187
- common-name:
- unsaturated gellan tetrasaccharide
- smiles:
- cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)oc4(oc(c([o-])=o)=cc(o)c(o)4)))
- inchi-key:
- jmdplhpaglyhci-pqvubfrasa-m
- molecular-weight:
- 645.544