Difference between revisions of "D-Xylopyranose"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-DEHYDRO-ASCORBATE == * common-name: ** l-dehydro-ascorbate * smiles: ** c(o)c(o)c1(c(=o)c(=o)c(=o)o1) * inchi-key: ** sbjkkffyizucet-sz...")
(Created page with "Category:metabolite == Metabolite mRNAs == * common-name: ** an mrna == Reaction(s) known to consume the compound == * POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN == Reacti...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-DEHYDRO-ASCORBATE ==
+
== Metabolite mRNAs ==
 
* common-name:
 
* common-name:
** l-dehydro-ascorbate
+
** an mrna
* smiles:
 
** c(o)c(o)c1(c(=o)c(=o)c(=o)o1)
 
* inchi-key:
 
** sbjkkffyizucet-szscbosdsa-n
 
* molecular-weight:
 
** 174.11
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.8.5.1-RXN]]
+
* [[POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN]]
* [[RXN-13185]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
+
* [[3.1.13.4-RXN]]
* [[ETHYL-RXN]]
+
* [[POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN]]
* [[RXN-12440]]
 
* [[RXN-13185]]
 
* [[RXN-19200]]
 
* [[RXN-7984]]
 
* [[RXN-7985]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-dehydro-ascorbate}}
+
{{#set: common-name=an mrna}}
{{#set: inchi-key=inchikey=sbjkkffyizucet-szscbosdsa-n}}
 
{{#set: molecular-weight=174.11}}
 

Revision as of 14:55, 5 January 2021

Metabolite mRNAs

  • common-name:
    • an mrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality