Difference between revisions of "CPD-19683"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Fatty-Aldehydes == * common-name: ** a fatty aldehyde == Reaction(s) known to consume the compound == * RXN-4142 == Reaction(s) known...") |
(Created page with "Category:metabolite == Metabolite CPD0-1445 == * common-name: ** l-alanyl-l-glutamate * smiles: ** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)[o-] * inchi-key: ** vyzagtdahuirqa-whf...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-1445 == |
* common-name: | * common-name: | ||
− | ** | + | ** l-alanyl-l-glutamate |
+ | * smiles: | ||
+ | ** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)[o-] | ||
+ | * inchi-key: | ||
+ | ** vyzagtdahuirqa-whfbiakzsa-m | ||
+ | * molecular-weight: | ||
+ | ** 217.201 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-6981]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-alanyl-l-glutamate}} |
+ | {{#set: inchi-key=inchikey=vyzagtdahuirqa-whfbiakzsa-m}} | ||
+ | {{#set: molecular-weight=217.201}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD0-1445
- common-name:
- l-alanyl-l-glutamate
- smiles:
- cc([n+])c(=o)nc(c([o-])=o)ccc(=o)[o-]
- inchi-key:
- vyzagtdahuirqa-whfbiakzsa-m
- molecular-weight:
- 217.201