Difference between revisions of "CIS-ACONITATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RIBOSE-1P == * common-name: ** α-d-ribose-1-phosphate * smiles: ** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1) * inchi-key: ** yxjdfqjker...") |
(Created page with "Category:metabolite == Metabolite Delta5-Delta7-Steroids == * common-name: ** a δ5,7-sterol == Reaction(s) known to consume the compound == * RXN-16378 == Reacti...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Delta5-Delta7-Steroids == |
* common-name: | * common-name: | ||
| − | ** & | + | ** a δ5,7-sterol |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16378]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16378]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=& | + | {{#set: common-name=a δ5,7-sterol}} |
| − | |||
| − | |||
Revision as of 14:55, 5 January 2021
Contents
Metabolite Delta5-Delta7-Steroids
- common-name:
- a δ5,7-sterol
