Difference between revisions of "CPD-19157"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7002 == * common-name: ** dihydrogeranylgeranyl diphosphate * smiles: ** cc(=cccc(=cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c...")
(Created page with "Category:metabolite == Metabolite LANOSTEROL == * common-name: ** lanosterol * smiles: ** cc(c)=cccc([ch]1(c2(c)(c(c)(cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c * i...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7002 ==
+
== Metabolite LANOSTEROL ==
 
* common-name:
 
* common-name:
** dihydrogeranylgeranyl diphosphate
+
** lanosterol
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
+
** cc(c)=cccc([ch]1(c2(c)(c(c)(cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c
 
* inchi-key:
 
* inchi-key:
** yjganofpasczbk-wcnzlwbosa-k
+
** cahgclmltwqznj-bqniitsrsa-n
 
* molecular-weight:
 
* molecular-weight:
** 449.44
+
** 426.724
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7658]]
+
* [[RXN3O-130]]
* [[RXN-7659]]
+
* [[RXN66-303]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7658]]
+
* [[LANOSTEROL-SYNTHASE-RXN]]
* [[RXN-7659]]
+
* [[RXN-15133]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dihydrogeranylgeranyl diphosphate}}
+
{{#set: common-name=lanosterol}}
{{#set: inchi-key=inchikey=yjganofpasczbk-wcnzlwbosa-k}}
+
{{#set: inchi-key=inchikey=cahgclmltwqznj-bqniitsrsa-n}}
{{#set: molecular-weight=449.44}}
+
{{#set: molecular-weight=426.724}}

Revision as of 14:55, 5 January 2021

Metabolite LANOSTEROL

  • common-name:
    • lanosterol
  • smiles:
    • cc(c)=cccc([ch]1(c2(c)(c(c)(cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c
  • inchi-key:
    • cahgclmltwqznj-bqniitsrsa-n
  • molecular-weight:
    • 426.724

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality