Difference between revisions of "CPD66-39"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-194 == * common-name: ** 4-nitrophenyl phosphate * smiles: ** c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1) * inchi-key: ** xzkihkmte...")
(Created page with "Category:metabolite == Metabolite 3-KETO-ADIPYL-COA == * common-name: ** 3-oxoadipyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-194 ==
+
== Metabolite 3-KETO-ADIPYL-COA ==
 
* common-name:
 
* common-name:
** 4-nitrophenyl phosphate
+
** 3-oxoadipyl-coa
 
* smiles:
 
* smiles:
** c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1)
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** xzkihkmtemtjqx-uhfffaoysa-l
+
** vkkkaapgxhwxoo-biewrjsysa-i
 
* molecular-weight:
 
* molecular-weight:
** 217.074
+
** 904.605
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
* [[RXN0-2044]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-2044]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-nitrophenyl phosphate}}
+
{{#set: common-name=3-oxoadipyl-coa}}
{{#set: inchi-key=inchikey=xzkihkmtemtjqx-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=vkkkaapgxhwxoo-biewrjsysa-i}}
{{#set: molecular-weight=217.074}}
+
{{#set: molecular-weight=904.605}}

Revision as of 14:55, 5 January 2021

Metabolite 3-KETO-ADIPYL-COA

  • common-name:
    • 3-oxoadipyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • vkkkaapgxhwxoo-biewrjsysa-i
  • molecular-weight:
    • 904.605

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality