Difference between revisions of "Cysteine-Desulfurase-L-cysteine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9646 == * common-name: ** di-trans,octa-cis-undecaprenyl phosphate * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(...")
(Created page with "Category:metabolite == Metabolite CPD-7953 == * common-name: ** torulene * smiles: ** cc(=cc=cc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)c)c)c)c)c * inchi-key...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9646 ==
+
== Metabolite CPD-7953 ==
 
* common-name:
 
* common-name:
** di-trans,octa-cis-undecaprenyl phosphate
+
** torulene
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])[o-])c)c)c
+
** cc(=cc=cc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** ufphfkctoziafy-ntdveaecsa-l
+
** aibohnyykwyqmm-mxbsltgdsa-n
 
* molecular-weight:
 
* molecular-weight:
** 845.279
+
** 534.867
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PHOSNACMURPENTATRANS-RXN]]
+
* [[RXN-11989]]
* [[RXN-11347]]
 
* [[RXN-8975]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8975]]
+
* [[RXN-11976]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=di-trans,octa-cis-undecaprenyl phosphate}}
+
{{#set: common-name=torulene}}
{{#set: inchi-key=inchikey=ufphfkctoziafy-ntdveaecsa-l}}
+
{{#set: inchi-key=inchikey=aibohnyykwyqmm-mxbsltgdsa-n}}
{{#set: molecular-weight=845.279}}
+
{{#set: molecular-weight=534.867}}

Revision as of 14:55, 5 January 2021

Metabolite CPD-7953

  • common-name:
    • torulene
  • smiles:
    • cc(=cc=cc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)c)c)c)c)c
  • inchi-key:
    • aibohnyykwyqmm-mxbsltgdsa-n
  • molecular-weight:
    • 534.867

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality