Difference between revisions of "N6-L-threonylcarbamoyladenine37-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ASP-tRNAs == * common-name: ** trnaasp == Reaction(s) known to consume the compound == * ASPARTATE--TRNA-LIGASE-RXN == Reaction(s) kn...")
(Created page with "Category:metabolite == Metabolite R-1-AMINOPROPAN-2-YL-PHOSPHATE == * common-name: ** (r)-1-amino-2-propanol o-2-phosphate * smiles: ** cc(c[n+])op(=o)([o-])[o-] * inchi-k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ASP-tRNAs ==
+
== Metabolite R-1-AMINOPROPAN-2-YL-PHOSPHATE ==
 
* common-name:
 
* common-name:
** trnaasp
+
** (r)-1-amino-2-propanol o-2-phosphate
 +
* smiles:
 +
** cc(c[n+])op(=o)([o-])[o-]
 +
* inchi-key:
 +
** ybolzujjguzudc-gsvougtgsa-m
 +
* molecular-weight:
 +
** 154.082
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ASPARTATE--TRNA-LIGASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[4.1.1.81-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trnaasp}}
+
{{#set: common-name=(r)-1-amino-2-propanol o-2-phosphate}}
 +
{{#set: inchi-key=inchikey=ybolzujjguzudc-gsvougtgsa-m}}
 +
{{#set: molecular-weight=154.082}}

Revision as of 14:56, 5 January 2021

Metabolite R-1-AMINOPROPAN-2-YL-PHOSPHATE

  • common-name:
    • (r)-1-amino-2-propanol o-2-phosphate
  • smiles:
    • cc(c[n+])op(=o)([o-])[o-]
  • inchi-key:
    • ybolzujjguzudc-gsvougtgsa-m
  • molecular-weight:
    • 154.082

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality