Difference between revisions of "CPD-5164"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite INOSITOL-1-4-5-TRISPHOSPHATE == * common-name: ** d-myo-inositol (1,4,5)-trisphosphate * smiles: ** c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)...")
(Created page with "Category:metabolite == Metabolite CPD-7676 == * common-name: ** methyl iodide * smiles: ** ci * inchi-key: ** inqombqausqdds-uhfffaoysa-n * molecular-weight: ** 141.939 ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite INOSITOL-1-4-5-TRISPHOSPHATE ==
+
== Metabolite CPD-7676 ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,4,5)-trisphosphate
+
** methyl iodide
 
* smiles:
 
* smiles:
** c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
+
** ci
 
* inchi-key:
 
* inchi-key:
** mmwciqzxvozegg-xjtpdsdzsa-h
+
** inqombqausqdds-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 414.049
+
** 141.939
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.127-RXN]]
 
* [[2.7.1.151-RXN]]
 
* [[3.1.3.56-RXN]]
 
* [[RXN-10948]]
 
* [[RXN-13197]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.4.11-RXN]]
+
* [[RXN-11241]]
* [[RXN-10948]]
 
* [[RXN-13197]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,4,5)-trisphosphate}}
+
{{#set: common-name=methyl iodide}}
{{#set: inchi-key=inchikey=mmwciqzxvozegg-xjtpdsdzsa-h}}
+
{{#set: inchi-key=inchikey=inqombqausqdds-uhfffaoysa-n}}
{{#set: molecular-weight=414.049}}
+
{{#set: molecular-weight=141.939}}

Revision as of 14:56, 5 January 2021

Metabolite CPD-7676

  • common-name:
    • methyl iodide
  • smiles:
    • ci
  • inchi-key:
    • inqombqausqdds-uhfffaoysa-n
  • molecular-weight:
    • 141.939

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality