Difference between revisions of "Cytochrome-c-N-O-methyl-arginines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-126 == * common-name: ** γ-carotene * smiles: ** cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)c)c)c)c)c * i...") |
(Created page with "Category:metabolite == Metabolite S-1-PHENYLETHANOL == * common-name: ** (s)-1-phenylethanol * smiles: ** cc(o)c1(c=cc=cc=1) * inchi-key: ** wapnohkvxsqrpx-zetcqymhsa-n *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite S-1-PHENYLETHANOL == |
* common-name: | * common-name: | ||
− | ** | + | ** (s)-1-phenylethanol |
* smiles: | * smiles: | ||
− | ** cc( | + | ** cc(o)c1(c=cc=cc=1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** wapnohkvxsqrpx-zetcqymhsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 122.166 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-1302]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-1302]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(s)-1-phenylethanol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wapnohkvxsqrpx-zetcqymhsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=122.166}} |
Revision as of 14:56, 5 January 2021
Contents
Metabolite S-1-PHENYLETHANOL
- common-name:
- (s)-1-phenylethanol
- smiles:
- cc(o)c1(c=cc=cc=1)
- inchi-key:
- wapnohkvxsqrpx-zetcqymhsa-n
- molecular-weight:
- 122.166