Difference between revisions of "CPD-9869"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Glutamine-synthetase-Tyr == * common-name: ** a [glutamine-synthetase]-l-tyrosine == Reaction(s) known to consume the compound == * GSA...")
(Created page with "Category:metabolite == Metabolite LINOLENOYL-COA == * common-name: ** α-linolenoyl-coa * smiles: ** ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Glutamine-synthetase-Tyr ==
+
== Metabolite LINOLENOYL-COA ==
 
* common-name:
 
* common-name:
** a [glutamine-synthetase]-l-tyrosine
+
** α-linolenoyl-coa
 +
* smiles:
 +
** ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-])op(=o)([o-])occ3(oc(n2(c=nc1(c(n)=nc=nc=12)))c(o)c(op(=o)([o-])[o-])3)
 +
* inchi-key:
 +
** omkfkbgzhnjnex-kzwmewpfsa-j
 +
* molecular-weight:
 +
** 1023.921
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GSADENYLATION-RXN]]
+
* [[RXN-13426]]
 +
* [[RXN-13441]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[LINOLENOYL-RXN]]
 +
* [[LNLNCACOAL]]
 +
* [[llcoas]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glutamine-synthetase]-l-tyrosine}}
+
{{#set: common-name=α-linolenoyl-coa}}
 +
{{#set: inchi-key=inchikey=omkfkbgzhnjnex-kzwmewpfsa-j}}
 +
{{#set: molecular-weight=1023.921}}

Revision as of 14:56, 5 January 2021

Metabolite LINOLENOYL-COA

  • common-name:
    • α-linolenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-])op(=o)([o-])occ3(oc(n2(c=nc1(c(n)=nc=nc=12)))c(o)c(op(=o)([o-])[o-])3)
  • inchi-key:
    • omkfkbgzhnjnex-kzwmewpfsa-j
  • molecular-weight:
    • 1023.921

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality