Difference between revisions of "CPD-329"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-TRYPTOPHAN == * common-name: ** 5-hydroxy-l-tryptophan * smiles: ** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+])) * inchi-key: ** l...")
(Created page with "Category:metabolite == Metabolite CPD-13357 == * common-name: ** (2r)-2,3-dihydroxy-3-methylbutanoate * smiles: ** cc(c)(o)c(o)c(=o)[o-] * inchi-key: ** jteykufkxgdteu-vkh...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-HYDROXY-TRYPTOPHAN ==
+
== Metabolite CPD-13357 ==
 
* common-name:
 
* common-name:
** 5-hydroxy-l-tryptophan
+
** (2r)-2,3-dihydroxy-3-methylbutanoate
 
* smiles:
 
* smiles:
** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+]))
+
** cc(c)(o)c(o)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** ldcyzajdbxycgn-vifpvbqesa-n
+
** jteykufkxgdteu-vkhmyheasa-m
 
* molecular-weight:
 
* molecular-weight:
** 220.227
+
** 133.124
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN3DJ-170]]
+
* [[DIHYDROXYISOVALDEHYDRAT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ACETOLACTREDUCTOISOM-RXN]]
 +
* [[KARI_LPAREN_23dhmb_RPAREN_]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-hydroxy-l-tryptophan}}
+
{{#set: common-name=(2r)-2,3-dihydroxy-3-methylbutanoate}}
{{#set: inchi-key=inchikey=ldcyzajdbxycgn-vifpvbqesa-n}}
+
{{#set: inchi-key=inchikey=jteykufkxgdteu-vkhmyheasa-m}}
{{#set: molecular-weight=220.227}}
+
{{#set: molecular-weight=133.124}}

Revision as of 14:56, 5 January 2021

Metabolite CPD-13357

  • common-name:
    • (2r)-2,3-dihydroxy-3-methylbutanoate
  • smiles:
    • cc(c)(o)c(o)c(=o)[o-]
  • inchi-key:
    • jteykufkxgdteu-vkhmyheasa-m
  • molecular-weight:
    • 133.124

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality