Difference between revisions of "Protein-L-Ser-or-L-Thr-P-L-Pro"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-24183 == == Reaction(s) known to consume the compound == * RXN-22205 == Reaction(s) known to produce the compound == * RXN-222...")
(Created page with "Category:metabolite == Metabolite CPD-7214 == * common-name: ** (2s)-dihydrotricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o) * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-24183 ==
+
== Metabolite CPD-7214 ==
 +
* common-name:
 +
** (2s)-dihydrotricetin
 +
* smiles:
 +
** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o)
 +
* inchi-key:
 +
** usqxpewrywrrjd-lbprgkrzsa-m
 +
* molecular-weight:
 +
** 303.248
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-22205 ]]
+
* [[RXN-7922]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-22204]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=(2s)-dihydrotricetin}}
 +
{{#set: inchi-key=inchikey=usqxpewrywrrjd-lbprgkrzsa-m}}
 +
{{#set: molecular-weight=303.248}}

Revision as of 14:57, 5 January 2021

Metabolite CPD-7214

  • common-name:
    • (2s)-dihydrotricetin
  • smiles:
    • c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o)
  • inchi-key:
    • usqxpewrywrrjd-lbprgkrzsa-m
  • molecular-weight:
    • 303.248

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality