Difference between revisions of "Release-factor-N5-Methyl-L-glutamine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 18-HYDROXYOLEATE == * common-name: ** 18-hydroxyoleate * smiles: ** c(o)cccccccc=ccccccccc(=o)[o-] * inchi-key: ** lquhzvlttwmbto-uphrsur...") |
(Created page with "Category:metabolite == Metabolite tRNA-Sec == * common-name: ** a trnasec == Reaction(s) known to consume the compound == * RXN0-2161 == Reaction(s) known to produce t...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite tRNA-Sec == |
* common-name: | * common-name: | ||
| − | ** | + | ** a trnasec |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-2161]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a trnasec}} |
| − | |||
| − | |||
Revision as of 14:57, 5 January 2021
Contents
Metabolite tRNA-Sec
- common-name:
- a trnasec
