Difference between revisions of "CPD-18493"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Peptide-with-N-terminal-Alanine == * common-name: ** a peptide with an n-terminal l-alanine == Reaction(s) known to consume the compound...")
(Created page with "Category:metabolite == Metabolite PHE == * common-name: ** l-phenylalanine * smiles: ** c([o-])(=o)c([n+])cc1(c=cc=cc=1) * inchi-key: ** colnvldhvkwlrt-qmmmgpobsa-n * mole...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Peptide-with-N-terminal-Alanine ==
+
== Metabolite PHE ==
 
* common-name:
 
* common-name:
** a peptide with an n-terminal l-alanine
+
** l-phenylalanine
 +
* smiles:
 +
** c([o-])(=o)c([n+])cc1(c=cc=cc=1)
 +
* inchi-key:
 +
** colnvldhvkwlrt-qmmmgpobsa-n
 +
* molecular-weight:
 +
** 165.191
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.4.11.2-RXN]]
+
* [[2.6.1.64-RXN]]
 +
* [[PHEAMINOTRANS-RXN]]
 +
* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
 +
* [[RXN-10814]]
 +
* [[RXN-17130]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.6.1.64-RXN]]
 +
* [[PHEAMINOTRANS-RXN]]
 +
* [[RXN-10814]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a peptide with an n-terminal l-alanine}}
+
{{#set: common-name=l-phenylalanine}}
 +
{{#set: inchi-key=inchikey=colnvldhvkwlrt-qmmmgpobsa-n}}
 +
{{#set: molecular-weight=165.191}}

Revision as of 14:57, 5 January 2021

Metabolite PHE

  • common-name:
    • l-phenylalanine
  • smiles:
    • c([o-])(=o)c([n+])cc1(c=cc=cc=1)
  • inchi-key:
    • colnvldhvkwlrt-qmmmgpobsa-n
  • molecular-weight:
    • 165.191

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality