Difference between revisions of "CPD-18493"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Peptide-with-N-terminal-Alanine == * common-name: ** a peptide with an n-terminal l-alanine == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite PHE == * common-name: ** l-phenylalanine * smiles: ** c([o-])(=o)c([n+])cc1(c=cc=cc=1) * inchi-key: ** colnvldhvkwlrt-qmmmgpobsa-n * mole...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PHE == |
* common-name: | * common-name: | ||
− | ** | + | ** l-phenylalanine |
+ | * smiles: | ||
+ | ** c([o-])(=o)c([n+])cc1(c=cc=cc=1) | ||
+ | * inchi-key: | ||
+ | ** colnvldhvkwlrt-qmmmgpobsa-n | ||
+ | * molecular-weight: | ||
+ | ** 165.191 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.6.1.64-RXN]] |
+ | * [[PHEAMINOTRANS-RXN]] | ||
+ | * [[PHENYLALANINE--TRNA-LIGASE-RXN]] | ||
+ | * [[RXN-10814]] | ||
+ | * [[RXN-17130]] | ||
+ | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2.6.1.64-RXN]] | ||
+ | * [[PHEAMINOTRANS-RXN]] | ||
+ | * [[RXN-10814]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-phenylalanine}} |
+ | {{#set: inchi-key=inchikey=colnvldhvkwlrt-qmmmgpobsa-n}} | ||
+ | {{#set: molecular-weight=165.191}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite PHE
- common-name:
- l-phenylalanine
- smiles:
- c([o-])(=o)c([n+])cc1(c=cc=cc=1)
- inchi-key:
- colnvldhvkwlrt-qmmmgpobsa-n
- molecular-weight:
- 165.191