Difference between revisions of "N-acetyl-D-galactosamine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11875 == * common-name: ** normetanephrine * smiles: ** coc1(=c(o)c=cc(c(o)c[n+])=c1) * inchi-key: ** ynyaywlbahxhll-qmmmgpobsa-o * m...") |
(Created page with "Category:metabolite == Metabolite SPERMIDINE == * common-name: ** spermidine * smiles: ** c([n+])cc[n+]cccc[n+] * inchi-key: ** athghqpfgpmsjy-uhfffaoysa-q * molecular-wei...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite SPERMIDINE == |
* common-name: | * common-name: | ||
− | ** | + | ** spermidine |
* smiles: | * smiles: | ||
− | ** | + | ** c([n+])cc[n+]cccc[n+] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** athghqpfgpmsjy-uhfffaoysa-q |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 148.271 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[2.5.1.46-RXN]] |
+ | * [[ABC-24-RXN]] | ||
+ | * [[RXN-11190]] | ||
+ | * [[RXN-13414]] | ||
+ | * [[SPERMIDINESYN-RXN]] | ||
+ | * [[SPERMINE-SYNTHASE-RXN]] | ||
+ | * [[SPMDtmi]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[ABC-24-RXN]] | ||
+ | * [[APAPT]] | ||
+ | * [[RXN-11190]] | ||
+ | * [[SPERMIDINESYN-RXN]] | ||
+ | * [[SPMDtmi]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=spermidine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=athghqpfgpmsjy-uhfffaoysa-q}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=148.271}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite SPERMIDINE
- common-name:
- spermidine
- smiles:
- c([n+])cc[n+]cccc[n+]
- inchi-key:
- athghqpfgpmsjy-uhfffaoysa-q
- molecular-weight:
- 148.271