Difference between revisions of "TETRACOSANOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PROPIONYL-COA == * common-name: ** propanoyl-coa * smiles: ** ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c...")
(Created page with "Category:metabolite == Metabolite CPD-231 == * common-name: ** 3-hydroxy-3-methyl-2-oxobutanoate * smiles: ** cc(c)(o)c(=o)c(=o)[o-] * inchi-key: ** dnopjxbponyblb-uhfffao...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PROPIONYL-COA ==
+
== Metabolite CPD-231 ==
 
* common-name:
 
* common-name:
** propanoyl-coa
+
** 3-hydroxy-3-methyl-2-oxobutanoate
 
* smiles:
 
* smiles:
** ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)(o)c(=o)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** qaqrevbbadehpa-iexphmlfsa-j
+
** dnopjxbponyblb-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 819.566
+
** 131.108
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[METHYLACETOACETYLCOATHIOL-RXN]]
+
* [[KARI_LPAREN_23dhmb_RPAREN_]]
* [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]]
 
* [[PPCOAOm]]
 
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.2.1.27-RXN]]
 
* [[2.3.1.176-RXN]]
 
* [[ACCAT]]
 
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 
* [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]]
 
* [[PPCOAOm]]
 
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
* [[RXN-11213]]
 
* [[RXN-12561]]
 
* [[RXN-7790]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=propanoyl-coa}}
+
{{#set: common-name=3-hydroxy-3-methyl-2-oxobutanoate}}
{{#set: inchi-key=inchikey=qaqrevbbadehpa-iexphmlfsa-j}}
+
{{#set: inchi-key=inchikey=dnopjxbponyblb-uhfffaoysa-m}}
{{#set: molecular-weight=819.566}}
+
{{#set: molecular-weight=131.108}}

Revision as of 14:57, 5 January 2021

Metabolite CPD-231

  • common-name:
    • 3-hydroxy-3-methyl-2-oxobutanoate
  • smiles:
    • cc(c)(o)c(=o)c(=o)[o-]
  • inchi-key:
    • dnopjxbponyblb-uhfffaoysa-m
  • molecular-weight:
    • 131.108

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality