Difference between revisions of "CPD-253"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17401 == * common-name: ** 3-oxo-auricoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(...")
(Created page with "Category:metabolite == Metabolite CPD0-2123 == * common-name: ** 3-oxodecanoyl-coa * smiles: ** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17401 ==
+
== Metabolite CPD0-2123 ==
 
* common-name:
 
* common-name:
** 3-oxo-auricoloyl-coa
+
** 3-oxodecanoyl-coa
 
* smiles:
 
* smiles:
** ccc=cccc(o)cc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** fgcwebktqlbclr-jrszcninsa-j
+
** azcvxmaplhsiky-hsjnekgzsa-j
 
* molecular-weight:
 
* molecular-weight:
** 1083.973
+
** 931.738
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16154]]
+
* [[ACACT4]]
 +
* [[HACD4h]]
 +
* [[RXN-13617]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16153]]
+
* [[ACACT4]]
 +
* [[ACACT4h]]
 +
* [[HACD4h]]
 +
* [[RXN-12490]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-auricoloyl-coa}}
+
{{#set: common-name=3-oxodecanoyl-coa}}
{{#set: inchi-key=inchikey=fgcwebktqlbclr-jrszcninsa-j}}
+
{{#set: inchi-key=inchikey=azcvxmaplhsiky-hsjnekgzsa-j}}
{{#set: molecular-weight=1083.973}}
+
{{#set: molecular-weight=931.738}}

Revision as of 14:57, 5 January 2021

Metabolite CPD0-2123

  • common-name:
    • 3-oxodecanoyl-coa
  • smiles:
    • cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • azcvxmaplhsiky-hsjnekgzsa-j
  • molecular-weight:
    • 931.738

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality