Difference between revisions of "Basic-Amino-Acids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PALMITYL-COA == * common-name: ** palmitoyl-coa * smiles: ** cccccccccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(...")
(Created page with "Category:metabolite == Metabolite CPD-253 == * common-name: ** 4,5-seco-dopa * smiles: ** c(=o)c=c(cc([n+])c(=o)[o-])c=c(c([o-])=o)o * inchi-key: ** fnegjfdtwwxqes-qtwonpp...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PALMITYL-COA ==
+
== Metabolite CPD-253 ==
 
* common-name:
 
* common-name:
** palmitoyl-coa
+
** 4,5-seco-dopa
 
* smiles:
 
* smiles:
** cccccccccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c(=o)c=c(cc([n+])c(=o)[o-])c=c(c([o-])=o)o
 
* inchi-key:
 
* inchi-key:
** mnbkluuykpbkdu-bbecnahfsa-j
+
** fnegjfdtwwxqes-qtwonppnsa-m
 
* molecular-weight:
 
* molecular-weight:
** 1001.915
+
** 228.181
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACOA160OR]]
 
* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
 
* [[PALMITOYL-COA-HYDROLASE-RXN]]
 
* [[RXN-10664]]
 
* [[RXN-11026-PALMITYL-COA/OXYGEN-MOLECULE//CPD0-2117/HYDROGEN-PEROXIDE.58.]]
 
* [[RXN-12547]]
 
* [[RXN-14554]]
 
* [[RXN-15066]]
 
* [[RXN-16032]]
 
* [[RXN-16065]]
 
* [[RXN-9543]]
 
* [[SERINE-C-PALMITOYLTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
+
* [[RXN-8460]]
* [[RXN-15066]]
 
* [[RXN-9623]]
 
* [[RXN3O-9780]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=palmitoyl-coa}}
+
{{#set: common-name=4,5-seco-dopa}}
{{#set: inchi-key=inchikey=mnbkluuykpbkdu-bbecnahfsa-j}}
+
{{#set: inchi-key=inchikey=fnegjfdtwwxqes-qtwonppnsa-m}}
{{#set: molecular-weight=1001.915}}
+
{{#set: molecular-weight=228.181}}

Revision as of 14:57, 5 January 2021

Metabolite CPD-253

  • common-name:
    • 4,5-seco-dopa
  • smiles:
    • c(=o)c=c(cc([n+])c(=o)[o-])c=c(c([o-])=o)o
  • inchi-key:
    • fnegjfdtwwxqes-qtwonppnsa-m
  • molecular-weight:
    • 228.181

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality