Difference between revisions of "CPD-17355"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9091 == * smiles: ** cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4...") |
(Created page with "Category:metabolite == Metabolite CPD-332 == * common-name: ** dihydrozeatin * smiles: ** cc(co)ccnc2(=nc=nc1(=c(n=cn1)2)) * inchi-key: ** xxfactaygkkoqb-zetcqymhsa-n * mo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-332 == |
| + | * common-name: | ||
| + | ** dihydrozeatin | ||
* smiles: | * smiles: | ||
| − | ** cc | + | ** cc(co)ccnc2(=nc=nc1(=c(n=cn1)2)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** xxfactaygkkoqb-zetcqymhsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 221.261 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-4726]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dihydrozeatin}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=xxfactaygkkoqb-zetcqymhsa-n}} |
| + | {{#set: molecular-weight=221.261}} | ||
Revision as of 14:57, 5 January 2021
Contents
Metabolite CPD-332
- common-name:
- dihydrozeatin
- smiles:
- cc(co)ccnc2(=nc=nc1(=c(n=cn1)2))
- inchi-key:
- xxfactaygkkoqb-zetcqymhsa-n
- molecular-weight:
- 221.261
